CAS 2172947-85-0 is the registry number for 1H-Indazole-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Indazole-1-sulfonamide (CAS 2172947-85-0) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: indazole-1-sulfonamide. InChIKey: AWIDPWYWDZWQGN-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | indazole-1-sulfonamide |
| InChIKey | AWIDPWYWDZWQGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NN2S(=O)(=O)N |
Computed by PubChem (NCBI)