CAS 2173232-79-4 appears in our catalog under these names: LOM612, 99+%, LOM612, LOM612, 98.68%, 98.68%, LOM612, 98.85%, LOM612 (Standard). Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 10 mg.
3-(dimethylamino)benzo[f][1,2]benzothiazole-4,9-dione (CAS 2173232-79-4) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 3-(dimethylamino)benzo[f][1,2]benzothiazole-4,9-dione. InChIKey: LMNFZYAIQJKFFX-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 3-(dimethylamino)benzo[f][1,2]benzothiazole-4,9-dione |
| InChIKey | LMNFZYAIQJKFFX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NSC2=C1C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)