Products 2173391-51-8
CAS 2173391-51-8 appears in our catalog under these names: (1R,5S)-1-(4-Bromophenyl)-3-Azabicyclo[3.1.0]Hexane Hydrochloride, 96%, (1R,5S)-1-(4-Bromophenyl)-3-azabicyclo[3.1.0]hexane (hydrochloride), 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R,5S)-1-(4-bromophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 2173391-51-8) is a chemical compound with the molecular formula C11H13BrClN and a molecular weight of 274.58 g/mol. IUPAC name: (1R,5S)-1-(4-bromophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: XTRMJIFWPPXPBN-XQKZEKTMSA-N.
| Molecular formula | C11H13BrClN |
|---|---|
| Molecular weight | 274.58 g/mol |
| IUPAC name | (1R,5S)-1-(4-bromophenyl)-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | XTRMJIFWPPXPBN-XQKZEKTMSA-N |
| SMILES | C1[C@H]2[C@@]1(CNC2)C3=CC=C(C=C3)Br.Cl |
Computed by PubChem (NCBI)