CAS 2177264-15-0 appears in our catalog under these names: TRANS-1-CBZ-4-AMINO-3-METHOXYPIPERIDINE HCL, 97%, benzyl trans-4-amino-3-methoxy-piperidine-1-carboxylate,hydrochloride, 97%, 97%, trans-1-cbz-4-amino-3-methoxypiperidine hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Benzyl (3R,4R)-4-amino-3-methoxypiperidine-1-carboxylate;hydrochloride (CAS 2177264-15-0) is a chemical compound with the molecular formula C14H21ClN2O3 and a molecular weight of 300.78 g/mol. IUPAC name: benzyl (3R,4R)-4-amino-3-methoxypiperidine-1-carboxylate;hydrochloride. InChIKey: HBTOPFVAMPQCDT-OJERSXHUSA-N.
| Molecular formula | C14H21ClN2O3 |
|---|---|
| Molecular weight | 300.78 g/mol |
| IUPAC name | benzyl (3R,4R)-4-amino-3-methoxypiperidine-1-carboxylate;hydrochloride |
| InChIKey | HBTOPFVAMPQCDT-OJERSXHUSA-N |
| SMILES | CO[C@@H]1CN(CC[C@H]1N)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)