Products 2173638-15-6
CAS 2173638-15-6 is the registry number for (2S,3aS,7aS)-1-(Phenylcarbamoyl)-octahydro-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S,3aS,7aS)-1-(phenylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (CAS 2173638-15-6) is a chemical compound with the molecular formula C16H20N2O3 and a molecular weight of 288.34 g/mol. IUPAC name: (2S,3aS,7aS)-1-(phenylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid. InChIKey: GRLYGYICNXISAZ-UBHSHLNASA-N.
| Molecular formula | C16H20N2O3 |
|---|---|
| Molecular weight | 288.34 g/mol |
| IUPAC name | (2S,3aS,7aS)-1-(phenylcarbamoyl)-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| InChIKey | GRLYGYICNXISAZ-UBHSHLNASA-N |
| SMILES | C1CC[C@H]2[C@@H](C1)C[C@H](N2C(=O)NC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)