Products 2173991-73-4
CAS 2173991-73-4 appears in our catalog under these names: Hydroxynorketamine Hydrochloride, Hydroxynorketamine Hydrochloride (100 μg/mL in Methanol). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5x1ml.
2-amino-2-(2-chlorophenyl)-6-hydroxycyclohexan-1-one;hydrochloride (CAS 2173991-73-4) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: 2-amino-2-(2-chlorophenyl)-6-hydroxycyclohexan-1-one;hydrochloride. InChIKey: ZQJVHBJDLMIKJK-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | 2-amino-2-(2-chlorophenyl)-6-hydroxycyclohexan-1-one;hydrochloride |
| InChIKey | ZQJVHBJDLMIKJK-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C(C1)(C2=CC=CC=C2Cl)N)O.Cl |
Computed by PubChem (NCBI)