Products 2173998-90-6
CAS 2173998-90-6 is the registry number for 7-Azaspiro(3.5)nonan-5-ol, oxalic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
7-azaspiro[3.5]nonan-9-ol;oxalic acid (CAS 2173998-90-6) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 7-azaspiro[3.5]nonan-9-ol;oxalic acid. InChIKey: QBPQWUDCNCUHTC-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 7-azaspiro[3.5]nonan-9-ol;oxalic acid |
| InChIKey | QBPQWUDCNCUHTC-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CCNCC2O.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)