Products 2173999-77-2
CAS 2173999-77-2 is the registry number for 2-(Cyanomethyl)-5-(dimethylamino)-1,3-oxazole-4-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(cyanomethyl)-5-(dimethylamino)-1,3-oxazole-4-carbonitrile (CAS 2173999-77-2) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 2-(cyanomethyl)-5-(dimethylamino)-1,3-oxazole-4-carbonitrile. InChIKey: ZSAYHWNWEBZSGW-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 2-(cyanomethyl)-5-(dimethylamino)-1,3-oxazole-4-carbonitrile |
| InChIKey | ZSAYHWNWEBZSGW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(N=C(O1)CC#N)C#N |
Computed by PubChem (NCBI)