CAS 2174001-81-9 is the registry number for rac-2-((1R,3S)-3-Aminocyclopentyl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(1S,3R)-3-aminocyclopentyl]acetic acid;hydrochloride (CAS 2174001-81-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: 2-[(1S,3R)-3-aminocyclopentyl]acetic acid;hydrochloride. InChIKey: ZYODZIQGSWUCJT-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | 2-[(1S,3R)-3-aminocyclopentyl]acetic acid;hydrochloride |
| InChIKey | ZYODZIQGSWUCJT-RIHPBJNCSA-N |
| SMILES | C1C[C@H](C[C@H]1CC(=O)O)N.Cl |
Computed by PubChem (NCBI)