CAS 2174007-60-2 is the registry number for tert-Butyl 3-ethynyl-4H,5H,6H,7H-pyrazolo(1,5-a)pyrazine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-ethynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 2174007-60-2) is a chemical compound with the molecular formula C13H17N3O2 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 3-ethynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: UBWIYZZAPOSXQT-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 3-ethynyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | UBWIYZZAPOSXQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=C(C=N2)C#C)C1 |
Computed by PubChem (NCBI)