CAS 21746-02-1 appears in our catalog under these names: Cefaclor Impurity 47, 3-phenyl-2,5-diketopiperazine, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g.
3-phenylpiperazine-2,5-dione (CAS 21746-02-1) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 3-phenylpiperazine-2,5-dione. InChIKey: CVXXCIJNZNETDW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 3-phenylpiperazine-2,5-dione |
| InChIKey | CVXXCIJNZNETDW-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(C(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)