Products 21771-88-0
CAS 21771-88-0 appears in our catalog under these names: 2-(4-Chlorophenyl)-2-phenylacetic acid, 95%, 2-(4-Chlorophenyl)-2-phenylacetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 10g, 250mg.
2-(4-chlorophenyl)-2-phenylacetic acid (CAS 21771-88-0) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-phenylacetic acid. InChIKey: YSPUGNBNEKEGKB-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-phenylacetic acid |
| InChIKey | YSPUGNBNEKEGKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)