Products 2177258-00-1
CAS 2177258-00-1 appears in our catalog under these names: (R)-3-(Pyrrolidin-2-yl)aniline dihydrochloride, 95%, (R)-3-(Pyrrolidin-2-yl)aniline dihydrochloride, 97+%, (R)-3-(PYRROLIDIN-2-YL)ANILINE 2HCL, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 1g.
3-[(2R)-pyrrolidin-2-yl]aniline;dihydrochloride (CAS 2177258-00-1) is a chemical compound with the molecular formula C10H16Cl2N2 and a molecular weight of 235.15 g/mol. IUPAC name: 3-[(2R)-pyrrolidin-2-yl]aniline;dihydrochloride. InChIKey: GLKASUHDSGOEJJ-YQFADDPSSA-N.
| Molecular formula | C10H16Cl2N2 |
|---|---|
| Molecular weight | 235.15 g/mol |
| IUPAC name | 3-[(2R)-pyrrolidin-2-yl]aniline;dihydrochloride |
| InChIKey | GLKASUHDSGOEJJ-YQFADDPSSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)