Products 2183489-21-4

CAS 2183489-21-4 is the registry number for 4-Hydroxypyridine-2,5-dicarboxylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-oxo-1H-pyridine-2,5-dicarboxylic acid (CAS 2183489-21-4) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 4-oxo-1H-pyridine-2,5-dicarboxylic acid. InChIKey: ONTUGERKWCTYSU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5NO5
Molecular weight183.12 g/mol
IUPAC name4-oxo-1H-pyridine-2,5-dicarboxylic acid
InChIKeyONTUGERKWCTYSU-UHFFFAOYSA-N
SMILESC1=C(NC=C(C1=O)C(=O)O)C(=O)O

Computed by PubChem (NCBI)