CAS 2183687-73-0 is the registry number for 1,3-Dihydro-1-(trifluoromethyl)-1,3-isobenzofurandiol. Offered by: Biosynth. Available pack sizes: 100mg, 50mg.
3-(trifluoromethyl)-1H-2-benzofuran-1,3-diol (CAS 2183687-73-0) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: 3-(trifluoromethyl)-1H-2-benzofuran-1,3-diol. InChIKey: UYAQXJROSBPXQN-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1H-2-benzofuran-1,3-diol |
| InChIKey | UYAQXJROSBPXQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(OC2(C(F)(F)F)O)O |
Computed by PubChem (NCBI)