CAS 218935-75-2 appears in our catalog under these names: (3-Aminobenzoyl)urea, 95%, (3-Aminobenzoyl)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-amino-N-carbamoylbenzamide (CAS 218935-75-2) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: 3-amino-N-carbamoylbenzamide. InChIKey: FHFKRZADODCCPL-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | 3-amino-N-carbamoylbenzamide |
| InChIKey | FHFKRZADODCCPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)NC(=O)N |
Computed by PubChem (NCBI)