CAS 21900-54-9 appears in our catalog under these names: 2-Chloro-4-fluorobenzoyl chloride, 2-Chloro-4-fluorobenzoyl Chloride, >98.0%(GC)(T), 2-Chloro-4-fluorobenzoylchloride 98%, 2-Chloro-4-fluorobenzoyl chloride, 95%. Offered by: Biosynth, TCI, Ambeed, Fluorochem. Available pack sizes: 50g, 25g, 5g, 100g, 1g.
2-chloro-4-fluorobenzoyl chloride (CAS 21900-54-9) is a chemical compound with the molecular formula C7H3Cl2FO and a molecular weight of 193.00 g/mol. IUPAC name: 2-chloro-4-fluorobenzoyl chloride. InChIKey: POIAZJJVWRVLBO-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2FO |
|---|---|
| Molecular weight | 193.00 g/mol |
| IUPAC name | 2-chloro-4-fluorobenzoyl chloride |
| InChIKey | POIAZJJVWRVLBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C(=O)Cl |
Computed by PubChem (NCBI)