CAS 2193059-25-3 is the registry number for 5-((4-Methylphenyl)methyl)-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-[(4-methylphenyl)methyl]-1,3-thiazol-2-amine;hydrochloride (CAS 2193059-25-3) is a chemical compound with the molecular formula C11H13ClN2S and a molecular weight of 240.75 g/mol. IUPAC name: 5-[(4-methylphenyl)methyl]-1,3-thiazol-2-amine;hydrochloride. InChIKey: ATQOEIGUGFHCKL-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | 5-[(4-methylphenyl)methyl]-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | ATQOEIGUGFHCKL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=CN=C(S2)N.Cl |
Computed by PubChem (NCBI)