CAS 2193064-85-4 is the registry number for 4-Amino-2,2-dimethyloxane-4-carboxamide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-amino-2,2-dimethyloxane-4-carboxamide;hydrochloride (CAS 2193064-85-4) is a chemical compound with the molecular formula C8H17ClN2O2 and a molecular weight of 208.68 g/mol. IUPAC name: 4-amino-2,2-dimethyloxane-4-carboxamide;hydrochloride. InChIKey: LVCIAECBLBIKSC-UHFFFAOYSA-N.
| Molecular formula | C8H17ClN2O2 |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 4-amino-2,2-dimethyloxane-4-carboxamide;hydrochloride |
| InChIKey | LVCIAECBLBIKSC-UHFFFAOYSA-N |
| SMILES | CC1(CC(CCO1)(C(=O)N)N)C.Cl |
Computed by PubChem (NCBI)