CAS 2193067-29-5 is the registry number for 1-{4-Hydroxy-6-methylfuro(2,3-d)pyrimidin-5-yl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-acetyl-6-methyl-3H-furo[2,3-d]pyrimidin-4-one (CAS 2193067-29-5) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-acetyl-6-methyl-3H-furo[2,3-d]pyrimidin-4-one. InChIKey: MRNBUJVPZNBWCT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 5-acetyl-6-methyl-3H-furo[2,3-d]pyrimidin-4-one |
| InChIKey | MRNBUJVPZNBWCT-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)N=CNC2=O)C(=O)C |
Computed by PubChem (NCBI)