Products 219320-15-7
CAS 219320-15-7 is the registry number for 1,1-Dimethylethyl 4-(methoxycarbonyl)benzeneacetate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
Methyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoate (CAS 219320-15-7) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: methyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoate. InChIKey: RGRJTJQQFNMOMP-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | methyl 4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoate |
| InChIKey | RGRJTJQQFNMOMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)