CAS 2193505-55-2 is the registry number for Mirabegron Impurity K. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-hydroxy-N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide (CAS 2193505-55-2) is a chemical compound with the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. IUPAC name: (2S)-2-hydroxy-N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide. InChIKey: YWGDTDSOHPHFAQ-HNNXBMFYSA-N.
| Molecular formula | C16H16N2O4 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | (2S)-2-hydroxy-N-[2-(4-nitrophenyl)ethyl]-2-phenylacetamide |
| InChIKey | YWGDTDSOHPHFAQ-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C(=O)NCCC2=CC=C(C=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)