Products 2195434-05-8
CAS 2195434-05-8 appears in our catalog under these names: OAT1/3-IN-2, 2-hydroxy-1,7,8-trimethoxy-3-methyl-9,10-anthracenedione, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg, 10mg, 20mg.
2-hydroxy-1,7,8-trimethoxy-3-methylanthracene-9,10-dione (CAS 2195434-05-8) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 2-hydroxy-1,7,8-trimethoxy-3-methylanthracene-9,10-dione. InChIKey: XABCJODNCUCTEQ-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 2-hydroxy-1,7,8-trimethoxy-3-methylanthracene-9,10-dione |
| InChIKey | XABCJODNCUCTEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1O)OC)C(=O)C3=C(C2=O)C=CC(=C3OC)OC |
Computed by PubChem (NCBI)