Products 2196448-47-0
CAS 2196448-47-0 is the registry number for EN1441, 99.67%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg.
6-chloro-3,3-dimethyl-4-prop-2-enoyl-1H-quinoxalin-2-one (CAS 2196448-47-0) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 6-chloro-3,3-dimethyl-4-prop-2-enoyl-1H-quinoxalin-2-one. InChIKey: RSKGPRCITYZGEE-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 6-chloro-3,3-dimethyl-4-prop-2-enoyl-1H-quinoxalin-2-one |
| InChIKey | RSKGPRCITYZGEE-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(N1C(=O)C=C)C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)