CAS 2197422-77-6 appears in our catalog under these names: Methyl 7-hydroxy-5-oxo-1,2,3,5-tetrahydroindolizine-3-carboxylate, 97%, methyl 7-hydroxy-5-oxo-1,2,3,5-tetrahydroindolizine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
Methyl 7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate (CAS 2197422-77-6) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: methyl 7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate. InChIKey: VBONALMXHBRKJA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | methyl 7-hydroxy-5-oxo-2,3-dihydro-1H-indolizine-3-carboxylate |
| InChIKey | VBONALMXHBRKJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2=CC(=CC(=O)N12)O |
Computed by PubChem (NCBI)