Products 2198585-45-2
CAS 2198585-45-2 is the registry number for Methyl 3-benzoylbicyclo[1.1.1]Pentane-1-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-benzoylbicyclo[1.1.1]pentane-1-carboxylate (CAS 2198585-45-2) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: methyl 3-benzoylbicyclo[1.1.1]pentane-1-carboxylate. InChIKey: JANHTPZPDXBEKQ-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | methyl 3-benzoylbicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | JANHTPZPDXBEKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)