CAS 219964-34-8 appears in our catalog under these names: E-4-((3-(Pyridin-3-yl)acrylamido)methyl)benzoic Acid, 4–((3–(pyridin–3–yl)acrylamido)methyl)benzoic acid, E-4-((3-(Pyridin-3-yl)acrylamido)methyl)benzoic Acid, 95%, 95%, (E)-4-((3-(PYRIDIN-3-YL)ACRYLAMIDO)METHYL)BENZOIC ACID, 95%. Offered by: TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-[[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]methyl]benzoic acid (CAS 219964-34-8) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 4-[[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]methyl]benzoic acid. InChIKey: QDAAAEOIOXECHP-VMPITWQZSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 4-[[[(E)-3-pyridin-3-ylprop-2-enoyl]amino]methyl]benzoic acid |
| InChIKey | QDAAAEOIOXECHP-VMPITWQZSA-N |
| SMILES | C1=CC(=CN=C1)/C=C/C(=O)NCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)