CAS 220227-29-2 appears in our catalog under these names: 4-Fluoro-2-(trifluoromethyl)benzyl alcohol, 97%, 4-Fluoro-2-(trifluoromethyl)benzyl alcohol, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
[4-fluoro-2-(trifluoromethyl)phenyl]methanol (CAS 220227-29-2) is a chemical compound with the molecular formula C8H6F4O and a molecular weight of 194.13 g/mol. IUPAC name: [4-fluoro-2-(trifluoromethyl)phenyl]methanol. InChIKey: QCDWCMMCVRWROH-UHFFFAOYSA-N.
| Molecular formula | C8H6F4O |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | [4-fluoro-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | QCDWCMMCVRWROH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)CO |
Computed by PubChem (NCBI)