Products 220665-51-0
CAS 220665-51-0 appears in our catalog under these names: (1S,2S)-1,2-di(naphthalen-2-yl)ethane-1,2-diamine, 98+%, 98+%, (1S,2S)-1,2-di(naphthalen-2-yl)ethane-1,2-diamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(1S,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine (CAS 220665-51-0) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: (1S,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine. InChIKey: FAHMSYSXFWQYOW-VXKWHMMOSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (1S,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine |
| InChIKey | FAHMSYSXFWQYOW-VXKWHMMOSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)[C@@H]([C@H](C3=CC4=CC=CC=C4C=C3)N)N |
Computed by PubChem (NCBI)