Products 220930-96-1
CAS 220930-96-1 is the registry number for Daidzein-3',5',8-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
8-deuterio-3-(3,5-dideuterio-4-hydroxyphenyl)-7-hydroxychromen-4-one (CAS 220930-96-1) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 257.25 g/mol. IUPAC name: 8-deuterio-3-(3,5-dideuterio-4-hydroxyphenyl)-7-hydroxychromen-4-one. InChIKey: ZQSIJRDFPHDXIC-BKWFQMGFSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 257.25 g/mol |
| IUPAC name | 8-deuterio-3-(3,5-dideuterio-4-hydroxyphenyl)-7-hydroxychromen-4-one |
| InChIKey | ZQSIJRDFPHDXIC-BKWFQMGFSA-N |
| SMILES | [2H]C1=CC(=CC(=C1O)[2H])C2=COC3=C(C2=O)C=CC(=C3[2H])O |
Computed by PubChem (NCBI)