CAS 291759-05-2 appears in our catalog under these names: Daidzein-d6, >95% (HPLC), Daidzein-d6, 98%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
6,8-dideuterio-7-hydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one (CAS 291759-05-2) is a chemical compound with the molecular formula C15H10O4 and a molecular weight of 260.27 g/mol. IUPAC name: 6,8-dideuterio-7-hydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one. InChIKey: ZQSIJRDFPHDXIC-UMCLXPAOSA-N.
| Molecular formula | C15H10O4 |
|---|---|
| Molecular weight | 260.27 g/mol |
| IUPAC name | 6,8-dideuterio-7-hydroxy-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)chromen-4-one |
| InChIKey | ZQSIJRDFPHDXIC-UMCLXPAOSA-N |
| SMILES | [2H]C1=CC2=C(C(=C1O)[2H])OC=C(C2=O)C3=C(C(=C(C(=C3[2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)