CAS 221010-68-0 appears in our catalog under these names: 9,9-Dimethyl-9H-fluorene-2,7-diol 97%, 9,9-Dimethyl-9H-fluorene-2,7-diol, 97%, 97%, 9,9-Dimethyl-9H-fluorene-2,7-diol, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
9,9-dimethylfluorene-2,7-diol (CAS 221010-68-0) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 9,9-dimethylfluorene-2,7-diol. InChIKey: UKXBEJOAGBKZHH-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 9,9-dimethylfluorene-2,7-diol |
| InChIKey | UKXBEJOAGBKZHH-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)O)C3=C1C=C(C=C3)O)C |
Computed by PubChem (NCBI)