CAS 22126-67-6 appears in our catalog under these names: Naphazoline EP Impurity D, Naphazoline Impurity 4(Naphazoline EP Impurity D), 2-(Naphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole, 98%, 2-(Naphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole, >95% (HPLC), 2-(Naphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 500mg.
2-(naphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole (CAS 22126-67-6) is a chemical compound with the molecular formula C14H14N2 and a molecular weight of 210.27 g/mol. IUPAC name: 2-(naphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole. InChIKey: VIXRKFBKWOHVBR-UHFFFAOYSA-N.
| Molecular formula | C14H14N2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-(naphthalen-2-ylmethyl)-4,5-dihydro-1H-imidazole |
| InChIKey | VIXRKFBKWOHVBR-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)CC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)