CAS 2213-81-2 is the registry number for 2-Chloro-5-(1,1-dimethylethyl)-1,3-dinitrobenzene. Offered by: TRC. Available pack sizes: 250mg.
5-tert-butyl-2-chloro-1,3-dinitrobenzene (CAS 2213-81-2) is a chemical compound with the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. IUPAC name: 5-tert-butyl-2-chloro-1,3-dinitrobenzene. InChIKey: FRFMLDNFLXIDSH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O4 |
|---|---|
| Molecular weight | 258.66 g/mol |
| IUPAC name | 5-tert-butyl-2-chloro-1,3-dinitrobenzene |
| InChIKey | FRFMLDNFLXIDSH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)[N+](=O)[O-])Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)