Products 2215-83-0
CAS 2215-83-0 appears in our catalog under these names: 2-Propenoic acid, 3-(4-phenoxyphenyl)-, 95%, (E)–3–(4–Phenoxyphenyl)acrylic acid, 4-Phenoxycinnamic acid, 3-(4-Phenoxyphenyl)acrylic acid, 98%, 98%, 3-(4-Phenoxyphenyl)acrylic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 0,25g, 0,5g, 2g, 5g.
(E)-3-(4-phenoxyphenyl)prop-2-enoic acid (CAS 2215-83-0) is a chemical compound with the molecular formula C15H12O3 and a molecular weight of 240.25 g/mol. IUPAC name: (E)-3-(4-phenoxyphenyl)prop-2-enoic acid. InChIKey: XWGDODCEQXQAFQ-DHZHZOJOSA-N.
| Molecular formula | C15H12O3 |
|---|---|
| Molecular weight | 240.25 g/mol |
| IUPAC name | (E)-3-(4-phenoxyphenyl)prop-2-enoic acid |
| InChIKey | XWGDODCEQXQAFQ-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)