CAS 221532-00-9 is the registry number for 4-Isopropoxy-4'-nitrobenzophenone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(4-nitrophenyl)-(4-propan-2-yloxyphenyl)methanone (CAS 221532-00-9) is a chemical compound with the molecular formula C16H15NO4 and a molecular weight of 285.29 g/mol. IUPAC name: (4-nitrophenyl)-(4-propan-2-yloxyphenyl)methanone. InChIKey: TVRVBFNDNURZJF-UHFFFAOYSA-N.
| Molecular formula | C16H15NO4 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (4-nitrophenyl)-(4-propan-2-yloxyphenyl)methanone |
| InChIKey | TVRVBFNDNURZJF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)