Products 2216747-15-6
CAS 2216747-15-6 appears in our catalog under these names: (S)-4-(1-Aminoethyl)-2-methoxybenzoic acid hydrochloride, 95%, (S)–4–(1–Aminoethyl)–2–methoxybenzoic acid hydrochloride, (S)-4-(1-Aminoethyl)-2-methoxybenzoic acid hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
4-[(1S)-1-aminoethyl]-2-methoxybenzoic acid;hydrochloride (CAS 2216747-15-6) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]-2-methoxybenzoic acid;hydrochloride. InChIKey: UGKRDVLGBIQASK-RGMNGODLSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]-2-methoxybenzoic acid;hydrochloride |
| InChIKey | UGKRDVLGBIQASK-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)C(=O)O)OC)N.Cl |
Computed by PubChem (NCBI)