Products 2219375-54-7
CAS 2219375-54-7 is the registry number for 4-Chloro-3-methyl-N-propylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-3-methyl-N-propylaniline;hydrochloride (CAS 2219375-54-7) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 4-chloro-3-methyl-N-propylaniline;hydrochloride. InChIKey: GCOCWMBEUQQCKX-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 4-chloro-3-methyl-N-propylaniline;hydrochloride |
| InChIKey | GCOCWMBEUQQCKX-UHFFFAOYSA-N |
| SMILES | CCCNC1=CC(=C(C=C1)Cl)C.Cl |
Computed by PubChem (NCBI)