Products 2219379-96-9

CAS 2219379-96-9 is the registry number for tert-Butyl 1,5-diazocane-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 1,5-diazocane-1-carboxylate;hydrochloride (CAS 2219379-96-9) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl 1,5-diazocane-1-carboxylate;hydrochloride. InChIKey: BSZMDASPZVXAHR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H23ClN2O2
Molecular weight250.76 g/mol
IUPAC nametert-butyl 1,5-diazocane-1-carboxylate;hydrochloride
InChIKeyBSZMDASPZVXAHR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCNCCC1.Cl

Computed by PubChem (NCBI)