CAS 2219408-02-1 is the registry number for 3-Chloro-4-methyl-N-propylaniline hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-chloro-4-methyl-N-propylaniline;hydrochloride (CAS 2219408-02-1) is a chemical compound with the molecular formula C10H15Cl2N and a molecular weight of 220.14 g/mol. IUPAC name: 3-chloro-4-methyl-N-propylaniline;hydrochloride. InChIKey: LPNXQCITIGMXLM-UHFFFAOYSA-N.
| Molecular formula | C10H15Cl2N |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | 3-chloro-4-methyl-N-propylaniline;hydrochloride |
| InChIKey | LPNXQCITIGMXLM-UHFFFAOYSA-N |
| SMILES | CCCNC1=CC(=C(C=C1)C)Cl.Cl |
Computed by PubChem (NCBI)