CAS 22198-75-0 appears in our catalog under these names: 1-(4-Chlorophenyl)-2-(ethylamino)propan-1-one Hydrochloride, >95% (HPLC), 4-Chloroethcathinone hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 2,5mg, 25mg, 50mg, 100mg.
1-(4-chlorophenyl)-2-(ethylamino)propan-1-one;hydrochloride (CAS 22198-75-0) is a chemical compound with the molecular formula C11H15Cl2NO and a molecular weight of 248.15 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(ethylamino)propan-1-one;hydrochloride. InChIKey: AENZBLLLJXXVMI-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2NO |
|---|---|
| Molecular weight | 248.15 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(ethylamino)propan-1-one;hydrochloride |
| InChIKey | AENZBLLLJXXVMI-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)