CAS 2224-83-1 is the registry number for 4-(4-Chlorophenyl)-1H-2,3-benzoxazin-1-one. Offered by: TRC. Available pack sizes: 500mg.
4-(4-chlorophenyl)-2,3-benzoxazin-1-one (CAS 2224-83-1) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,3-benzoxazin-1-one. InChIKey: WFOBHUVYJHLWLG-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,3-benzoxazin-1-one |
| InChIKey | WFOBHUVYJHLWLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NOC2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)