Products 22246-10-2
CAS 22246-10-2 is the registry number for 7-Nitro-3,4-dihydroquinolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-nitro-3,4-dihydro-1H-quinolin-2-one (CAS 22246-10-2) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 7-nitro-3,4-dihydro-1H-quinolin-2-one. InChIKey: IQXSJDQRPGHCFE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 7-nitro-3,4-dihydro-1H-quinolin-2-one |
| InChIKey | IQXSJDQRPGHCFE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)