CAS 22246-84-0 appears in our catalog under these names: Brexpiprazole Impurity 84, 8-Hydroxy-1,3,4,5-tetrahydro-2H-benzo[b]azepin-2-one, 98%, Brexpiprazole Impurity 47. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
8-hydroxy-1,3,4,5-tetrahydro-1-benzazepin-2-one (CAS 22246-84-0) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 8-hydroxy-1,3,4,5-tetrahydro-1-benzazepin-2-one. InChIKey: WEGLOXRRKPYARS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 8-hydroxy-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| InChIKey | WEGLOXRRKPYARS-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(C=C2)O)NC(=O)C1 |
Computed by PubChem (NCBI)