Products 2225147-12-4
CAS 2225147-12-4 is the registry number for (6-Cyclopropyloxan-2-yl)methanesulfonamides. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(6-cyclopropyloxan-2-yl)methanesulfonamide (CAS 2225147-12-4) is a chemical compound with the molecular formula C9H17NO3S and a molecular weight of 219.30 g/mol. IUPAC name: (6-cyclopropyloxan-2-yl)methanesulfonamide. InChIKey: PVVZFWBLLKHTOD-UHFFFAOYSA-N.
| Molecular formula | C9H17NO3S |
|---|---|
| Molecular weight | 219.30 g/mol |
| IUPAC name | (6-cyclopropyloxan-2-yl)methanesulfonamide |
| InChIKey | PVVZFWBLLKHTOD-UHFFFAOYSA-N |
| SMILES | C1CC(OC(C1)C2CC2)CS(=O)(=O)N |
Computed by PubChem (NCBI)