CAS 2225154-32-3 is the registry number for 3,4-Dihydro-2H-1,4-benzoxazine-7-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid;hydrochloride (CAS 2225154-32-3) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid;hydrochloride. InChIKey: HIDZKOMVRCUBFL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid;hydrochloride |
| InChIKey | HIDZKOMVRCUBFL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=CC(=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)