Products 2225170-93-2
CAS 2225170-93-2 is the registry number for 2–Ethyl–5–cyanopyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(5-cyano-2-ethyl-3-pyridinyl)boronic acid (CAS 2225170-93-2) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (5-cyano-2-ethyl-3-pyridinyl)boronic acid. InChIKey: RPKHXBHNRZDAJH-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (5-cyano-2-ethyl-3-pyridinyl)boronic acid |
| InChIKey | RPKHXBHNRZDAJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1CC)C#N)(O)O |
Computed by PubChem (NCBI)