Products 2225172-03-0
CAS 2225172-03-0 is the registry number for B-[3-(4-Methyl-1H-imidazol-1-yl)phenyl]boronic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
[3-(4-methylimidazol-1-yl)phenyl]boronic acid (CAS 2225172-03-0) is a chemical compound with the molecular formula C10H11BN2O2 and a molecular weight of 202.02 g/mol. IUPAC name: [3-(4-methylimidazol-1-yl)phenyl]boronic acid. InChIKey: ZMEWFFGROOYYGK-UHFFFAOYSA-N.
| Molecular formula | C10H11BN2O2 |
|---|---|
| Molecular weight | 202.02 g/mol |
| IUPAC name | [3-(4-methylimidazol-1-yl)phenyl]boronic acid |
| InChIKey | ZMEWFFGROOYYGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2C=C(N=C2)C)(O)O |
Computed by PubChem (NCBI)