CAS 2225174-91-2 is the registry number for 3–Cyclopropyl–5–(piperidino)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(3-cyclopropyl-5-piperidin-1-ylphenyl)boronic acid (CAS 2225174-91-2) is a chemical compound with the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. IUPAC name: (3-cyclopropyl-5-piperidin-1-ylphenyl)boronic acid. InChIKey: PFSVPFBPPLBANR-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO2 |
|---|---|
| Molecular weight | 245.13 g/mol |
| IUPAC name | (3-cyclopropyl-5-piperidin-1-ylphenyl)boronic acid |
| InChIKey | PFSVPFBPPLBANR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N2CCCCC2)C3CC3)(O)O |
Computed by PubChem (NCBI)