Products 2225180-02-7
CAS 2225180-02-7 is the registry number for 3–(Cyclopentyl)pyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(3-cyclopentyl-4-pyridinyl)boronic acid (CAS 2225180-02-7) is a chemical compound with the molecular formula C10H14BNO2 and a molecular weight of 191.04 g/mol. IUPAC name: (3-cyclopentyl-4-pyridinyl)boronic acid. InChIKey: QQTHSTZWEZRPJT-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO2 |
|---|---|
| Molecular weight | 191.04 g/mol |
| IUPAC name | (3-cyclopentyl-4-pyridinyl)boronic acid |
| InChIKey | QQTHSTZWEZRPJT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=NC=C1)C2CCCC2)(O)O |
Computed by PubChem (NCBI)